C16H19N5O6 — CID 168841339
[(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[4-(hydroxyamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 168841339) has the molecular formula C16H19N5O6 and a molecular weight of 377.36 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[4-(hydroxyamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[4-(hydroxyamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 168841339 |
| Molecular Formula | C16H19N5O6 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[4-(hydroxyamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC[C@H]1O[C@@](C#N)(c2ccc3c(NO)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H19N5O6/c1-8(2)15(24)26-5-10-12(22)13(23)16(6-17,27-10)11-4-3-9-14(20-25)18-7-19-21(9)11/h3-4,7-8,10,12-13,22-23,25H,5H2,1-2H3,(H,18,19,20)/t10-,12-,13-,16+/m1/s1 |
| InChIKey | PENVXXHUVRICBP-VSBTWAGUSA-N |
| XLogP | -0.43 |
| TPSA | 162.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|