C15H19N5O4 — CID 170107853
(2R,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)-2-[4-(propan-2-ylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolane-2-carbonitrile (PubChem CID 170107853) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is (2R,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)-2-[4-(propan-2-ylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolane-2-carbonitrile.
| Compound Name | (2R,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)-2-[4-(propan-2-ylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 170107853 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (2R,3R,4S)-3,4-dihydroxy-5-(hydroxymethyl)-2-[4-(propan-2-ylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolane-2-carbonitrile |
| SMILES | CC(C)Nc1ncnn2c([C@]3(C#N)OC(CO)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C15H19N5O4/c1-8(2)19-14-9-3-4-11(20(9)18-7-17-14)15(6-16)13(23)12(22)10(5-21)24-15/h3-4,7-8,10,12-13,21-23H,5H2,1-2H3,(H,17,18,19)/t10?,12-,13-,15+/m1/s1 |
| InChIKey | VOCPIHZGPBEPGA-PZRQGZHWSA-N |
| XLogP | -0.62 |
| TPSA | 135.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |