C24H27N5O6 — CID 167257932
[(2R,3S,4R,5R)-5-cyano-4-hydroxy-2-(hydroxymethyl)-5-[4-[[hydroxy(phenyl)methyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-3-yl] 3-methylbutanoate (PubChem CID 167257932) has the molecular formula C24H27N5O6 and a molecular weight of 481.51 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-cyano-4-hydroxy-2-(hydroxymethyl)-5-[4-[[hydroxy(phenyl)methyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-3-yl] 3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-cyano-4-hydroxy-2-(hydroxymethyl)-5-[4-[[hydroxy(phenyl)methyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-3-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 167257932 |
| Molecular Formula | C24H27N5O6 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | [(2R,3S,4R,5R)-5-cyano-4-hydroxy-2-(hydroxymethyl)-5-[4-[[hydroxy(phenyl)methyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-3-yl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)O[C@H]1[C@@H](O)[C@](C#N)(c2ccc3c(NC(O)c4ccccc4)ncnn23)O[C@@H]1CO |
| InChI | InChI=1S/C24H27N5O6/c1-14(2)10-19(31)34-20-17(11-30)35-24(12-25,21(20)32)18-9-8-16-22(26-13-27-29(16)18)28-23(33)15-6-4-3-5-7-15/h3-9,13-14,17,20-21,23,30,32-33H,10-11H2,1-2H3,(H,26,27,28)/t17-,20-,21-,23?,24+/m1/s1 |
| InChIKey | UCADGIVIIRROQO-DDTLCISMSA-N |
| XLogP | 1.26 |
| TPSA | 162.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|