C30H35N5O7 — CID 170054858
[(2R,3S,4R,5R)-5-cyano-4-hydroxy-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-[(2-phenylacetyl)oxymethyl]oxolan-3-yl] (2S)-2,3-dimethylbutanoate (PubChem CID 170054858) has the molecular formula C30H35N5O7 and a molecular weight of 577.64 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-cyano-4-hydroxy-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-[(2-phenylacetyl)oxymethyl]oxolan-3-yl] (2S)-2,3-dimethylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-cyano-4-hydroxy-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-[(2-phenylacetyl)oxymethyl]oxolan-3-yl] (2S)-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 170054858 |
| Molecular Formula | C30H35N5O7 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | [(2R,3S,4R,5R)-5-cyano-4-hydroxy-5-[4-(2-methylpropanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-[(2-phenylacetyl)oxymethyl]oxolan-3-yl] (2S)-2,3-dimethylbutanoate |
| SMILES | CC(C)C(=O)Nc1ncnn2c([C@]3(C#N)O[C@H](COC(=O)Cc4ccccc4)[C@@H](OC(=O)[C@@H](C)C(C)C)[C@H]3O)ccc12 |
| InChI | InChI=1S/C30H35N5O7/c1-17(2)19(5)29(39)41-25-22(14-40-24(36)13-20-9-7-6-8-10-20)42-30(15-31,26(25)37)23-12-11-21-27(32-16-33-35(21)23)34-28(38)18(3)4/h6-12,16-19,22,25-26,37H,13-14H2,1-5H3,(H,32,33,34,38)/t19-,22+,25+,26+,30-/m0/s1 |
| InChIKey | NHJWZSUDGMBXKC-YPOQWPQCSA-N |
| XLogP | 2.79 |
| TPSA | 165.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |