C33H42N6O8 — CID 171807886
[(2R,3S,4R,5R)-5-[4-[(2-butoxy-2-methylpropanoyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-4-hydroxy-2-[(2-phenylacetyl)oxymethyl]oxolan-3-yl] (2R)-2-amino-3-methylbutanoate (PubChem CID 171807886) has the molecular formula C33H42N6O8 and a molecular weight of 650.73 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-[(2-butoxy-2-methylpropanoyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-4-hydroxy-2-[(2-phenylacetyl)oxymethyl]oxolan-3-yl] (2R)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-[4-[(2-butoxy-2-methylpropanoyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-4-hydroxy-2-[(2-phenylacetyl)oxymethyl]oxolan-3-yl] (2R)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 171807886 |
| Molecular Formula | C33H42N6O8 |
| Molecular Weight | 650.73 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-[(2-butoxy-2-methylpropanoyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-4-hydroxy-2-[(2-phenylacetyl)oxymethyl]oxolan-3-yl] (2R)-2-amino-3-methylbutanoate |
| SMILES | CCCCOC(C)(C)C(=O)Nc1ncnn2c([C@]3(C#N)O[C@H](COC(=O)Cc4ccccc4)[C@@H](OC(=O)[C@H](N)C(C)C)[C@H]3O)ccc12 |
| InChI | InChI=1S/C33H42N6O8/c1-6-7-15-45-32(4,5)31(43)38-29-22-13-14-24(39(22)37-19-36-29)33(18-34)28(41)27(46-30(42)26(35)20(2)3)23(47-33)17-44-25(40)16-21-11-9-8-10-12-21/h8-14,19-20,23,26-28,41H,6-7,15-17,35H2,1-5H3,(H,36,37,38,43)/t23-,26-,27-,28-,33+/m1/s1 |
| InChIKey | WQFKDRMPTAJMLD-UZVMFTGTSA-N |
| XLogP | 2.42 |
| TPSA | 200.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.73 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|