C25H27N5O6 — CID 174107670
[(2R,4R,5R)-5-cyano-4-hydroxy-5-[4-[(2-methoxy-2-methylpropanoyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 2-phenylacetate (PubChem CID 174107670) has the molecular formula C25H27N5O6 and a molecular weight of 493.52 g/mol. Its IUPAC name is [(2R,4R,5R)-5-cyano-4-hydroxy-5-[4-[(2-methoxy-2-methylpropanoyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 2-phenylacetate.
| Compound Name | [(2R,4R,5R)-5-cyano-4-hydroxy-5-[4-[(2-methoxy-2-methylpropanoyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 2-phenylacetate |
|---|---|
| PubChem CID | 174107670 |
| Molecular Formula | C25H27N5O6 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | [(2R,4R,5R)-5-cyano-4-hydroxy-5-[4-[(2-methoxy-2-methylpropanoyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 2-phenylacetate |
| SMILES | COC(C)(C)C(=O)Nc1ncnn2c([C@]3(C#N)O[C@@H](COC(=O)Cc4ccccc4)C[C@H]3O)ccc12 |
| InChI | InChI=1S/C25H27N5O6/c1-24(2,34-3)23(33)29-22-18-9-10-19(30(18)28-15-27-22)25(14-26)20(31)12-17(36-25)13-35-21(32)11-16-7-5-4-6-8-16/h4-10,15,17,20,31H,11-13H2,1-3H3,(H,27,28,29,33)/t17-,20-,25+/m1/s1 |
| InChIKey | XQESWRMOPMZJOH-CVBYOTHMSA-N |
| XLogP | 1.75 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |