C21H27N5O4 — CID 174107790
[(2R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxyoxolan-2-yl]methyl 2-cycloheptylacetate (PubChem CID 174107790) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is [(2R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxyoxolan-2-yl]methyl 2-cycloheptylacetate.
| Compound Name | [(2R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxyoxolan-2-yl]methyl 2-cycloheptylacetate |
|---|---|
| PubChem CID | 174107790 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | [(2R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxyoxolan-2-yl]methyl 2-cycloheptylacetate |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@@H](COC(=O)CC2CCCCCC2)C[C@H]1O |
| InChI | InChI=1S/C21H27N5O4/c22-12-21(17-8-7-16-20(23)24-13-25-26(16)17)18(27)10-15(30-21)11-29-19(28)9-14-5-3-1-2-4-6-14/h7-8,13-15,18,27H,1-6,9-11H2,(H2,23,24,25)/t15-,18-,21+/m1/s1 |
| InChIKey | KFJCSZHSSWCGHO-FPDPHYFHSA-N |
| XLogP | 2.08 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |