C25H34N6O6 — CID 166530815
[(2R,3S,4R,5R)-5-[4-[[(2S)-2-amino-3-methylbutanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-cyclohexylacetate (PubChem CID 166530815) has the molecular formula C25H34N6O6 and a molecular weight of 514.58 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-[[(2S)-2-amino-3-methylbutanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-cyclohexylacetate.
| Compound Name | [(2R,3S,4R,5R)-5-[4-[[(2S)-2-amino-3-methylbutanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-cyclohexylacetate |
|---|---|
| PubChem CID | 166530815 |
| Molecular Formula | C25H34N6O6 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-[[(2S)-2-amino-3-methylbutanoyl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-cyclohexylacetate |
| SMILES | CC(C)[C@H](N)C(=O)Nc1ncnn2c([C@]3(C#N)O[C@H](COC(=O)CC4CCCCC4)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C25H34N6O6/c1-14(2)20(27)24(35)30-23-16-8-9-18(31(16)29-13-28-23)25(12-26)22(34)21(33)17(37-25)11-36-19(32)10-15-6-4-3-5-7-15/h8-9,13-15,17,20-22,33-34H,3-7,10-11,27H2,1-2H3,(H,28,29,30,35)/t17-,20+,21-,22-,25+/m1/s1 |
| InChIKey | CADILVGUQYURQM-NEMUNFNQSA-N |
| XLogP | 1.00 |
| TPSA | 185.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |