C29H41N5O6 — CID 174107739
[(2R,4R,5R)-5-[4-[(2-butoxy-2-methylpropanoyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-4-hydroxyoxolan-2-yl]methyl 2-cycloheptylacetate (PubChem CID 174107739) has the molecular formula C29H41N5O6 and a molecular weight of 555.68 g/mol. Its IUPAC name is [(2R,4R,5R)-5-[4-[(2-butoxy-2-methylpropanoyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-4-hydroxyoxolan-2-yl]methyl 2-cycloheptylacetate.
| Compound Name | [(2R,4R,5R)-5-[4-[(2-butoxy-2-methylpropanoyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-4-hydroxyoxolan-2-yl]methyl 2-cycloheptylacetate |
|---|---|
| PubChem CID | 174107739 |
| Molecular Formula | C29H41N5O6 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | [(2R,4R,5R)-5-[4-[(2-butoxy-2-methylpropanoyl)amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-4-hydroxyoxolan-2-yl]methyl 2-cycloheptylacetate |
| SMILES | CCCCOC(C)(C)C(=O)Nc1ncnn2c([C@]3(C#N)O[C@@H](COC(=O)CC4CCCCCC4)C[C@H]3O)ccc12 |
| InChI | InChI=1S/C29H41N5O6/c1-4-5-14-39-28(2,3)27(37)33-26-22-12-13-23(34(22)32-19-31-26)29(18-30)24(35)16-21(40-29)17-38-25(36)15-20-10-8-6-7-9-11-20/h12-13,19-21,24,35H,4-11,14-17H2,1-3H3,(H,31,32,33,37)/t21-,24-,29+/m1/s1 |
| InChIKey | IGJSPXHRANNWJT-OGQCEUPSSA-N |
| XLogP | 4.04 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|