C27H37N5O6 — CID 170054948
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-(2-cyclohexylacetyl)oxy-4-hydroxyoxolan-2-yl]methyl (2S)-2,3,3-trimethylbutanoate (PubChem CID 170054948) has the molecular formula C27H37N5O6 and a molecular weight of 527.62 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-(2-cyclohexylacetyl)oxy-4-hydroxyoxolan-2-yl]methyl (2S)-2,3,3-trimethylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-(2-cyclohexylacetyl)oxy-4-hydroxyoxolan-2-yl]methyl (2S)-2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 170054948 |
| Molecular Formula | C27H37N5O6 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-(2-cyclohexylacetyl)oxy-4-hydroxyoxolan-2-yl]methyl (2S)-2,3,3-trimethylbutanoate |
| SMILES | C[C@H](C(=O)OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1OC(=O)CC1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C27H37N5O6/c1-16(26(2,3)4)25(35)36-13-19-22(37-21(33)12-17-8-6-5-7-9-17)23(34)27(14-28,38-19)20-11-10-18-24(29)30-15-31-32(18)20/h10-11,15-17,19,22-23,34H,5-9,12-13H2,1-4H3,(H2,29,30,31)/t16-,19-,22-,23-,27+/m1/s1 |
| InChIKey | JLWXWXWADVIMES-JXLNFVIGSA-N |
| XLogP | 2.90 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |