C22H29N5O6 — CID 170054997
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxy-3-propanoyloxyoxolan-2-yl]methyl (2S)-2,3,3-trimethylbutanoate (PubChem CID 170054997) has the molecular formula C22H29N5O6 and a molecular weight of 459.50 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxy-3-propanoyloxyoxolan-2-yl]methyl (2S)-2,3,3-trimethylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxy-3-propanoyloxyoxolan-2-yl]methyl (2S)-2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 170054997 |
| Molecular Formula | C22H29N5O6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxy-3-propanoyloxyoxolan-2-yl]methyl (2S)-2,3,3-trimethylbutanoate |
| SMILES | CCC(=O)O[C@H]1[C@@H](O)[C@](C#N)(c2ccc3c(N)ncnn23)O[C@@H]1COC(=O)[C@@H](C)C(C)(C)C |
| InChI | InChI=1S/C22H29N5O6/c1-6-16(28)32-17-14(9-31-20(30)12(2)21(3,4)5)33-22(10-23,18(17)29)15-8-7-13-19(24)25-11-26-27(13)15/h7-8,11-12,14,17-18,29H,6,9H2,1-5H3,(H2,24,25,26)/t12-,14-,17-,18-,22+/m1/s1 |
| InChIKey | SYTQBYZJIHGONX-ITORSBMKSA-N |
| XLogP | 1.34 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |