C21H21N5O4 — CID 170054835
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-ethyl-4-hydroxyoxolan-3-yl] 2-phenylacetate (PubChem CID 170054835) has the molecular formula C21H21N5O4 and a molecular weight of 407.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-ethyl-4-hydroxyoxolan-3-yl] 2-phenylacetate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-ethyl-4-hydroxyoxolan-3-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 170054835 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-ethyl-4-hydroxyoxolan-3-yl] 2-phenylacetate |
| SMILES | CC[C@@H]1[C@H]([C@H]([C@](O1)(C#N)C2=CC=C3N2N=CN=C3N)O)OC(=O)CC4=CC=CC=C4 |
| InChI | InChI=1S/C21H21N5O4/c1-2-15-18(29-17(27)10-13-6-4-3-5-7-13)19(28)21(11-22,30-15)16-9-8-14-20(23)24-12-25-26(14)16/h3-9,12,15,18-19,28H,2,10H2,1H3,(H2,23,24,25)/t15-,18-,19-,21+/m1/s1 |
| InChIKey | RMWPEOUTFYEBGN-FEGHXTNJSA-N |
| XLogP | 1.80 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | 678 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |