C34H35N5O7 — CID 172874196
[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-ethylbutanoate (PubChem CID 172874196) has the molecular formula C34H35N5O7 and a molecular weight of 625.68 g/mol. Its IUPAC name is [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-ethylbutanoate.
| Compound Name | [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-ethylbutanoate |
|---|---|
| PubChem CID | 172874196 |
| Molecular Formula | C34H35N5O7 |
| Molecular Weight | 625.68 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | [5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)OCC1OC(C#N)(c2ccc3c(N)ncnn23)C(OC(=O)Cc2ccccc2)C1OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C34H35N5O7/c1-3-24(4-2)33(42)43-19-26-30(44-28(40)17-22-11-7-5-8-12-22)31(45-29(41)18-23-13-9-6-10-14-23)34(20-35,46-26)27-16-15-25-32(36)37-21-38-39(25)27/h5-16,21,24,26,30-31H,3-4,17-19H2,1-2H3,(H2,36,37,38) |
| InChIKey | QACMDBZSAVJLPS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 168.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.68 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|