C21H25N5O10 — CID 169042946
[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-bis(ethoxycarbonyloxy)oxolan-2-yl]methyl ethyl carbonate (PubChem CID 169042946) has the molecular formula C21H25N5O10 and a molecular weight of 507.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-bis(ethoxycarbonyloxy)oxolan-2-yl]methyl ethyl carbonate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-bis(ethoxycarbonyloxy)oxolan-2-yl]methyl ethyl carbonate |
|---|---|
| PubChem CID | 169042946 |
| Molecular Formula | C21H25N5O10 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-bis(ethoxycarbonyloxy)oxolan-2-yl]methyl ethyl carbonate |
| SMILES | CCOC(=O)OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](OC(=O)OCC)[C@@H]1OC(=O)OCC |
| InChI | InChI=1S/C21H25N5O10/c1-4-30-18(27)33-9-13-15(34-19(28)31-5-2)16(35-20(29)32-6-3)21(10-22,36-13)14-8-7-12-17(23)24-11-25-26(12)14/h7-8,11,13,15-16H,4-6,9H2,1-3H3,(H2,23,24,25)/t13-,15-,16-,21+/m1/s1 |
| InChIKey | GXSKBUCEWKLTLQ-KBCRCOCESA-N |
| XLogP | 1.69 |
| TPSA | 195.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|