C21H26N6O6 — CID 177255097
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) carbonate (PubChem CID 177255097) has the molecular formula C21H26N6O6 and a molecular weight of 458.48 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) carbonate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) carbonate |
|---|---|
| PubChem CID | 177255097 |
| Molecular Formula | C21H26N6O6 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) carbonate |
| SMILES | CN1C2CCC1CC(OC(=O)OC[C@H]1O[C@@](C#N)(c3ccc4c(N)ncnn34)[C@H](O)[C@@H]1O)C2 |
| InChI | InChI=1S/C21H26N6O6/c1-26-11-2-3-12(26)7-13(6-11)32-20(30)31-8-15-17(28)18(29)21(9-22,33-15)16-5-4-14-19(23)24-10-25-27(14)16/h4-5,10-13,15,17-18,28-29H,2-3,6-8H2,1H3,(H2,23,24,25)/t11?,12?,13?,15-,17-,18-,21+/m1/s1 |
| InChIKey | IELDNOWBTRNGAW-XRLZUEFSSA-N |
| XLogP | -0.07 |
| TPSA | 168.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |