C15H15N5O6 — CID 170229753
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl ethenyl carbonate (PubChem CID 170229753) has the molecular formula C15H15N5O6 and a molecular weight of 361.31 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl ethenyl carbonate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl ethenyl carbonate |
|---|---|
| PubChem CID | 170229753 |
| Molecular Formula | C15H15N5O6 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl ethenyl carbonate |
| SMILES | C=COC(=O)OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H15N5O6/c1-2-24-14(23)25-5-9-11(21)12(22)15(6-16,26-9)10-4-3-8-13(17)18-7-19-20(8)10/h2-4,7,9,11-12,21-22H,1,5H2,(H2,17,18,19)/t9-,11-,12-,15+/m1/s1 |
| InChIKey | CZNXNGUCFXOJLS-CGEWXTDFSA-N |
| XLogP | -0.55 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|