C13H16N5O6P — CID 174116898
[(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-methylphosphinic acid (PubChem CID 174116898) has the molecular formula C13H16N5O6P and a molecular weight of 369.27 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-methylphosphinic acid.
| Compound Name | [(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 174116898 |
| Molecular Formula | C13H16N5O6P |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-methylphosphinic acid |
| SMILES | CP(=O)(O)OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@@H](O)C1O |
| InChI | InChI=1S/C13H16N5O6P/c1-25(21,22)23-4-8-10(19)11(20)13(5-14,24-8)9-3-2-7-12(15)16-6-17-18(7)9/h2-3,6,8,10-11,19-20H,4H2,1H3,(H,21,22)(H2,15,16,17)/t8-,10?,11+,13+/m1/s1 |
| InChIKey | IQSNDXRPHLQNIC-STVJRHAMSA-N |
| XLogP | -1.02 |
| TPSA | 176.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|