C12H16N7O5P — CID 155339349
amino-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methylamino]phosphinic acid (PubChem CID 155339349) has the molecular formula C12H16N7O5P and a molecular weight of 369.28 g/mol. Its IUPAC name is amino-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methylamino]phosphinic acid.
| Compound Name | amino-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methylamino]phosphinic acid |
|---|---|
| PubChem CID | 155339349 |
| Molecular Formula | C12H16N7O5P |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | amino-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methylamino]phosphinic acid |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@H](CNP(N)(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16N7O5P/c13-4-12(8-2-1-6-11(14)16-5-17-19(6)8)10(21)9(20)7(24-12)3-18-25(15,22)23/h1-2,5,7,9-10,20-21H,3H2,(H2,14,16,17)(H4,15,18,22,23)/t7-,9-,10-,12+/m1/s1 |
| InChIKey | VUUCLVKOXINPRX-LTGWCKQJSA-N |
| XLogP | -2.20 |
| TPSA | 205.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|