C14H16N5O9P — CID 169174107
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-phosphonooxyacetate (PubChem CID 169174107) has the molecular formula C14H16N5O9P and a molecular weight of 429.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-phosphonooxyacetate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-phosphonooxyacetate |
|---|---|
| PubChem CID | 169174107 |
| Molecular Formula | C14H16N5O9P |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-phosphonooxyacetate |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@H](COC(=O)COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H16N5O9P/c15-5-14(9-2-1-7-13(16)17-6-18-19(7)9)12(22)11(21)8(28-14)3-26-10(20)4-27-29(23,24)25/h1-2,6,8,11-12,21-22H,3-4H2,(H2,16,17,18)(H2,23,24,25)/t8-,11-,12-,14+/m1/s1 |
| InChIKey | XZFBBOIGZVRKFJ-PBFTVQBMSA-N |
| XLogP | -2.20 |
| TPSA | 222.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|