C25H34N6O8 — CID 169043012
cyclopentylmethyl (2S,3R)-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxycarbonyloxy]-2-(dimethylamino)butanoate (PubChem CID 169043012) has the molecular formula C25H34N6O8 and a molecular weight of 546.58 g/mol. Its IUPAC name is cyclopentylmethyl (2S,3R)-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxycarbonyloxy]-2-(dimethylamino)butanoate.
| Compound Name | cyclopentylmethyl (2S,3R)-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxycarbonyloxy]-2-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 169043012 |
| Molecular Formula | C25H34N6O8 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | cyclopentylmethyl (2S,3R)-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxycarbonyloxy]-2-(dimethylamino)butanoate |
| SMILES | C[C@@H](OC(=O)OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)[C@@H](C(=O)OCC1CCCC1)N(C)C |
| InChI | InChI=1S/C25H34N6O8/c1-14(19(30(2)3)23(34)36-10-15-6-4-5-7-15)38-24(35)37-11-17-20(32)21(33)25(12-26,39-17)18-9-8-16-22(27)28-13-29-31(16)18/h8-9,13-15,17,19-21,32-33H,4-7,10-11H2,1-3H3,(H2,27,28,29)/t14-,17-,19+,20-,21-,25+/m1/s1 |
| InChIKey | IHMJCCUNRMBDOK-CUFWVZFJSA-N |
| XLogP | 0.36 |
| TPSA | 194.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |