C26H33N5O7 — CID 166530960
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyanooxolan-2-yl]methyl 2-cyclohexyl-2-methylpropanoate (PubChem CID 166530960) has the molecular formula C26H33N5O7 and a molecular weight of 527.58 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyanooxolan-2-yl]methyl 2-cyclohexyl-2-methylpropanoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyanooxolan-2-yl]methyl 2-cyclohexyl-2-methylpropanoate |
|---|---|
| PubChem CID | 166530960 |
| Molecular Formula | C26H33N5O7 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyanooxolan-2-yl]methyl 2-cyclohexyl-2-methylpropanoate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)[C@](C#N)(c2ccc3c(N)ncnn23)O[C@@H]1COC(=O)C(C)(C)C1CCCCC1 |
| InChI | InChI=1S/C26H33N5O7/c1-15(32)36-21-19(12-35-24(34)25(3,4)17-8-6-5-7-9-17)38-26(13-27,22(21)37-16(2)33)20-11-10-18-23(28)29-14-30-31(18)20/h10-11,14,17,19,21-22H,5-9,12H2,1-4H3,(H2,28,29,30)/t19-,21-,22-,26+/m1/s1 |
| InChIKey | RNOXLPXZCZHBRI-XTOGBABISA-N |
| XLogP | 2.44 |
| TPSA | 168.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|