C18H22N4O7 — CID 167081646
[(2R,3R,4R,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methyloxolan-2-yl]methyl acetate (PubChem CID 167081646) has the molecular formula C18H22N4O7 and a molecular weight of 406.40 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methyloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 167081646 |
| Molecular Formula | C18H22N4O7 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methyloxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@](C)(c2ccc3c(N)ncnn23)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H22N4O7/c1-9(23)26-7-13-15(27-10(2)24)16(28-11(3)25)18(4,29-13)14-6-5-12-17(19)20-8-21-22(12)14/h5-6,8,13,15-16H,7H2,1-4H3,(H2,19,20,21)/t13-,15-,16-,18+/m1/s1 |
| InChIKey | KJORLPNGSRBTTG-IIVZCXTMSA-N |
| XLogP | 0.35 |
| TPSA | 144.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|