C25H37N5O7 — CID 167006299
[(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methyl-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 167006299) has the molecular formula C25H37N5O7 and a molecular weight of 519.60 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methyl-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methyl-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 167006299 |
| Molecular Formula | C25H37N5O7 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | [(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methyl-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)C(=O)O[C@H]1[C@@H](OC(=O)C(C)C)[C@](C)(c2ccc3c(N)ncnn23)O[C@@H]1COC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C25H37N5O7/c1-12(2)18(26)24(33)34-10-16-19(35-22(31)13(3)4)20(36-23(32)14(5)6)25(7,37-16)17-9-8-15-21(27)28-11-29-30(15)17/h8-9,11-14,16,18-20H,10,26H2,1-7H3,(H2,27,28,29)/t16-,18+,19-,20-,25+/m1/s1 |
| InChIKey | BQICQSWQCBIHGY-JUVHOOAWSA-N |
| XLogP | 1.59 |
| TPSA | 170.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|