C24H33N5O10 — CID 170057348
[(2R,3S,4R,5S)-5-[4-(acetyloxymethoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-5-methyl-3-propanoyloxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 170057348) has the molecular formula C24H33N5O10 and a molecular weight of 551.55 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-[4-(acetyloxymethoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-5-methyl-3-propanoyloxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5S)-5-[4-(acetyloxymethoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-5-methyl-3-propanoyloxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 170057348 |
| Molecular Formula | C24H33N5O10 |
| Molecular Weight | 551.55 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | [(2R,3S,4R,5S)-5-[4-(acetyloxymethoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-5-methyl-3-propanoyloxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CCC(=O)O[C@H]1[C@@H](O)[C@](C)(c2ccc3c(NC(=O)OCOC(C)=O)ncnn23)O[C@@H]1COC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C24H33N5O10/c1-6-17(31)38-19-15(9-35-22(33)18(25)12(2)3)39-24(5,20(19)32)16-8-7-14-21(26-10-27-29(14)16)28-23(34)37-11-36-13(4)30/h7-8,10,12,15,18-20,32H,6,9,11,25H2,1-5H3,(H,26,27,28,34)/t15-,18+,19-,20-,24+/m1/s1 |
| InChIKey | QFXRCSZIUOYXLU-RDKBWNCDSA-N |
| XLogP | 0.62 |
| TPSA | 202.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.55 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|