C19H26N4O6 — CID 170056350
[(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-2-(hydroxymethyl)-5-methyloxolan-3-yl] propanoate (PubChem CID 170056350) has the molecular formula C19H26N4O6 and a molecular weight of 406.44 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-2-(hydroxymethyl)-5-methyloxolan-3-yl] propanoate.
| Compound Name | [(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-2-(hydroxymethyl)-5-methyloxolan-3-yl] propanoate |
|---|---|
| PubChem CID | 170056350 |
| Molecular Formula | C19H26N4O6 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-2-(hydroxymethyl)-5-methyloxolan-3-yl] propanoate |
| SMILES | CCCC(=O)Nc1ncnn2c([C@]3(C)O[C@H](CO)[C@@H](OC(=O)CC)[C@H]3O)ccc12 |
| InChI | InChI=1S/C19H26N4O6/c1-4-6-14(25)22-18-11-7-8-13(23(11)21-10-20-18)19(3)17(27)16(12(9-24)29-19)28-15(26)5-2/h7-8,10,12,16-17,24,27H,4-6,9H2,1-3H3,(H,20,21,22,25)/t12-,16-,17-,19+/m1/s1 |
| InChIKey | ZMVGEPHCVKRDJR-LOFBVBFDSA-N |
| XLogP | 0.76 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |