C24H35N5O6 — CID 170057281
[(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxy-5-methyloxolan-2-yl]methyl 2-(1-aminocyclohexyl)acetate (PubChem CID 170057281) has the molecular formula C24H35N5O6 and a molecular weight of 489.57 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxy-5-methyloxolan-2-yl]methyl 2-(1-aminocyclohexyl)acetate.
| Compound Name | [(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxy-5-methyloxolan-2-yl]methyl 2-(1-aminocyclohexyl)acetate |
|---|---|
| PubChem CID | 170057281 |
| Molecular Formula | C24H35N5O6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | [(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4-dihydroxy-5-methyloxolan-2-yl]methyl 2-(1-aminocyclohexyl)acetate |
| SMILES | CCCC(=O)Nc1ncnn2c([C@]3(C)O[C@H](COC(=O)CC4(N)CCCCC4)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C24H35N5O6/c1-3-7-18(30)28-22-15-8-9-17(29(15)27-14-26-22)23(2)21(33)20(32)16(35-23)13-34-19(31)12-24(25)10-5-4-6-11-24/h8-9,14,16,20-21,32-33H,3-7,10-13,25H2,1-2H3,(H,26,27,28,30)/t16-,20-,21-,23+/m1/s1 |
| InChIKey | LRKZXPWSJAIBMU-SUIZVZERSA-N |
| XLogP | 1.40 |
| TPSA | 161.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |