C24H30N4O6 — CID 167257733
N-[7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-[(1-hydroxy-2-phenylethoxy)methyl]-2-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]butanamide (PubChem CID 167257733) has the molecular formula C24H30N4O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is N-[7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-[(1-hydroxy-2-phenylethoxy)methyl]-2-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]butanamide.
| Compound Name | N-[7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-[(1-hydroxy-2-phenylethoxy)methyl]-2-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]butanamide |
|---|---|
| PubChem CID | 167257733 |
| Molecular Formula | C24H30N4O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N-[7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-[(1-hydroxy-2-phenylethoxy)methyl]-2-methyloxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]butanamide |
| SMILES | CCCC(=O)Nc1ncnn2c([C@]3(C)O[C@H](COC(O)Cc4ccccc4)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C24H30N4O6/c1-3-7-19(29)27-23-16-10-11-18(28(16)26-14-25-23)24(2)22(32)21(31)17(34-24)13-33-20(30)12-15-8-5-4-6-9-15/h4-6,8-11,14,17,20-22,30-32H,3,7,12-13H2,1-2H3,(H,25,26,27,29)/t17-,20?,21-,22-,24+/m1/s1 |
| InChIKey | LRMVKTGUFBZTRL-XDUQUGOGSA-N |
| XLogP | 1.38 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|