C20H28N4O6 — CID 170056368
[(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-2-(hydroxymethyl)-5-methyloxolan-3-yl] 2-methylpropanoate (PubChem CID 170056368) has the molecular formula C20H28N4O6 and a molecular weight of 420.47 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-2-(hydroxymethyl)-5-methyloxolan-3-yl] 2-methylpropanoate.
| Compound Name | [(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-2-(hydroxymethyl)-5-methyloxolan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 170056368 |
| Molecular Formula | C20H28N4O6 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | [(2R,3S,4R,5S)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-2-(hydroxymethyl)-5-methyloxolan-3-yl] 2-methylpropanoate |
| SMILES | CCCC(=O)Nc1ncnn2c([C@]3(C)O[C@H](CO)[C@@H](OC(=O)C(C)C)[C@H]3O)ccc12 |
| InChI | InChI=1S/C20H28N4O6/c1-5-6-15(26)23-18-12-7-8-14(24(12)22-10-21-18)20(4)17(27)16(13(9-25)30-20)29-19(28)11(2)3/h7-8,10-11,13,16-17,25,27H,5-6,9H2,1-4H3,(H,21,22,23,26)/t13-,16-,17-,20+/m1/s1 |
| InChIKey | FZMXIQPXWKJLHR-RKURPORMSA-N |
| XLogP | 1.00 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |