C22H27N5O6 — CID 170288103
[(1R,3R,4R,5S)-3-cyano-3-[4-(hexanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] 2-methylpropanoate (PubChem CID 170288103) has the molecular formula C22H27N5O6 and a molecular weight of 457.49 g/mol. Its IUPAC name is [(1R,3R,4R,5S)-3-cyano-3-[4-(hexanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] 2-methylpropanoate.
| Compound Name | [(1R,3R,4R,5S)-3-cyano-3-[4-(hexanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 170288103 |
| Molecular Formula | C22H27N5O6 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | [(1R,3R,4R,5S)-3-cyano-3-[4-(hexanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] 2-methylpropanoate |
| SMILES | CCCCCC(=O)Nc1ncnn2c([C@]3(C#N)O[C@@H]4C(OC(=O)C(C)C)[C@]4(O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C22H27N5O6/c1-4-5-6-7-15(28)26-18-13-8-9-14(27(13)25-11-24-18)21(10-23)20(30)22(31)16(17(22)33-21)32-19(29)12(2)3/h8-9,11-12,16-17,20,30-31H,4-7H2,1-3H3,(H,24,25,26,28)/t16?,17-,20+,21+,22-/m1/s1 |
| InChIKey | BHUXFNWQYXZWKI-DMWNDTRGSA-N |
| XLogP | 1.04 |
| TPSA | 159.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|