C12H11N5O5PS+ — CID 167057289
[(1R,3R,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-oxo-sulfanylphosphanium (PubChem CID 167057289) has the molecular formula C12H11N5O5PS+ and a molecular weight of 368.29 g/mol. Its IUPAC name is [(1R,3R,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-oxo-sulfanylphosphanium.
| Compound Name | [(1R,3R,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-oxo-sulfanylphosphanium |
|---|---|
| PubChem CID | 167057289 |
| Molecular Formula | C12H11N5O5PS+ |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | [(1R,3R,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-oxo-sulfanylphosphanium |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@@H]2C(O[P+](=O)S)[C@]2(O)[C@H]1O |
| InChI | InChI=1S/C12H10N5O5PS/c13-3-11(6-2-1-5-9(14)15-4-16-17(5)6)10(18)12(19)7(21-11)8(12)22-23(20)24/h1-2,4,7-8,10,18-19H,(H2-,14,15,16,20,24)/p+1/t7-,8?,10+,11+,12+/m1/s1 |
| InChIKey | RWYNZYIQGFVBRB-PFDXQSEBSA-O |
| XLogP | -0.49 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|