C19H21N5O5 — CID 167006325
[(1R,3R,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] cyclohexanecarboxylate (PubChem CID 167006325) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is [(1R,3R,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] cyclohexanecarboxylate.
| Compound Name | [(1R,3R,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 167006325 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [(1R,3R,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl] cyclohexanecarboxylate |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@@H]2C(OC(=O)C3CCCCC3)[C@]2(O)[C@H]1O |
| InChI | InChI=1S/C19H21N5O5/c20-8-18(12-7-6-11-15(21)22-9-23-24(11)12)17(26)19(27)13(14(19)29-18)28-16(25)10-4-2-1-3-5-10/h6-7,9-10,13-14,17,26-27H,1-5H2,(H2,21,22,23)/t13?,14-,17+,18+,19-/m1/s1 |
| InChIKey | BPGFCSAOAWWKIW-DMOGFEGYSA-N |
| XLogP | 0.03 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |