C20H26N4O6 — CID 170197741
[(1R,3S,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4,5-dihydroxy-3-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] cyclohexylmethyl carbonate (PubChem CID 170197741) has the molecular formula C20H26N4O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is [(1R,3S,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4,5-dihydroxy-3-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] cyclohexylmethyl carbonate.
| Compound Name | [(1R,3S,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4,5-dihydroxy-3-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] cyclohexylmethyl carbonate |
|---|---|
| PubChem CID | 170197741 |
| Molecular Formula | C20H26N4O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [(1R,3S,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4,5-dihydroxy-3-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] cyclohexylmethyl carbonate |
| SMILES | C[C@@]1(c2ccc3c(N)ncnn23)O[C@@H]2C(OC(=O)OCC3CCCCC3)[C@]2(O)[C@H]1O |
| InChI | InChI=1S/C20H26N4O6/c1-19(13-8-7-12-16(21)22-10-23-24(12)13)17(25)20(27)14(15(20)30-19)29-18(26)28-9-11-5-3-2-4-6-11/h7-8,10-11,14-15,17,25,27H,2-6,9H2,1H3,(H2,21,22,23)/t14?,15-,17+,19+,20-/m1/s1 |
| InChIKey | UNKFWDDOXCWIIU-QCHRJDJZSA-N |
| XLogP | 1.13 |
| TPSA | 141.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |