C23H32N4O6 — CID 170200927
[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl [(2R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl] carbonate (PubChem CID 170200927) has the molecular formula C23H32N4O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl [(2R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl] carbonate.
| Compound Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl [(2R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl] carbonate |
|---|---|
| PubChem CID | 170200927 |
| Molecular Formula | C23H32N4O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl [(2R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl] carbonate |
| SMILES | CC12CCC(C1)C(C)(C)[C@@H]2OC(=O)OC[C@H]1O[C@@](C)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H32N4O6/c1-21(2)12-7-8-22(3,9-12)19(21)32-20(30)31-10-14-16(28)17(29)23(4,33-14)15-6-5-13-18(24)25-11-26-27(13)15/h5-6,11-12,14,16-17,19,28-29H,7-10H2,1-4H3,(H2,24,25,26)/t12?,14-,16-,17-,19+,22?,23+/m1/s1 |
| InChIKey | NBLZWZJANJVEIS-WUXZHPPDSA-N |
| XLogP | 2.02 |
| TPSA | 141.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |