C21H33N5O7P+ — CID 174116980
[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-oxophosphanium (PubChem CID 174116980) has the molecular formula C21H33N5O7P+ and a molecular weight of 498.50 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-oxophosphanium.
| Compound Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-oxophosphanium |
|---|---|
| PubChem CID | 174116980 |
| Molecular Formula | C21H33N5O7P+ |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-oxophosphanium |
| SMILES | CCC(CC)COC(=O)[C@H](C)N[P+](=O)OC[C@H]1O[C@@](C)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H33N5O7P/c1-5-13(6-2)9-31-20(29)12(3)25-34(30)32-10-15-17(27)18(28)21(4,33-15)16-8-7-14-19(22)23-11-24-26(14)16/h7-8,11-13,15,17-18,27-28H,5-6,9-10H2,1-4H3,(H,25,30)(H2,22,23,24)/q+1/t12-,15+,17+,18+,21-/m0/s1 |
| InChIKey | JANPDPGSXNYXJC-KOHYREPUSA-N |
| XLogP | 1.28 |
| TPSA | 170.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|