C20H26F2N4O5 — CID 170056841
[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl 2-(4,4-difluorocyclohexyl)acetate (PubChem CID 170056841) has the molecular formula C20H26F2N4O5 and a molecular weight of 440.45 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl 2-(4,4-difluorocyclohexyl)acetate.
| Compound Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl 2-(4,4-difluorocyclohexyl)acetate |
|---|---|
| PubChem CID | 170056841 |
| Molecular Formula | C20H26F2N4O5 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl 2-(4,4-difluorocyclohexyl)acetate |
| SMILES | C[C@@]1(c2ccc3c(N)ncnn23)O[C@H](COC(=O)CC2CCC(F)(F)CC2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H26F2N4O5/c1-19(14-3-2-12-18(23)24-10-25-26(12)14)17(29)16(28)13(31-19)9-30-15(27)8-11-4-6-20(21,22)7-5-11/h2-3,10-11,13,16-17,28-29H,4-9H2,1H3,(H2,23,24,25)/t13-,16-,17-,19+/m1/s1 |
| InChIKey | HSUFFBQWJGZZRZ-QUIPCFFLSA-N |
| XLogP | 1.41 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |