C18H24N4O5 — CID 167258638
[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methyl-3-propanoyloxyoxolan-2-yl]methyl propanoate (PubChem CID 167258638) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methyl-3-propanoyloxyoxolan-2-yl]methyl propanoate.
| Compound Name | [(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methyl-3-propanoyloxyoxolan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 167258638 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-methyl-3-propanoyloxyoxolan-2-yl]methyl propanoate |
| SMILES | CCC(=O)OC[C@H]1O[C@@](C)(c2ccc3c(N)ncnn23)C[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C18H24N4O5/c1-4-15(23)25-9-13-12(26-16(24)5-2)8-18(3,27-13)14-7-6-11-17(19)20-10-21-22(11)14/h6-7,10,12-13H,4-5,8-9H2,1-3H3,(H2,19,20,21)/t12-,13+,18+/m0/s1 |
| InChIKey | RXLUIXRVHDQOLE-VEVIJQCQSA-N |
| XLogP | 1.59 |
| TPSA | 118.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |