C21H30N4O7 — CID 170056044
[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-hydroxy-5-methyl-3-propanoyloxyoxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate (PubChem CID 170056044) has the molecular formula C21H30N4O7 and a molecular weight of 450.49 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-hydroxy-5-methyl-3-propanoyloxyoxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-hydroxy-5-methyl-3-propanoyloxyoxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 170056044 |
| Molecular Formula | C21H30N4O7 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-hydroxy-5-methyl-3-propanoyloxyoxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate |
| SMILES | CCC(=O)O[C@H]1[C@@H](O)[C@](C)(c2ccc3c(N)ncnn23)O[C@@H]1COCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H30N4O7/c1-6-15(26)31-16-13(9-29-11-30-19(28)20(2,3)4)32-21(5,17(16)27)14-8-7-12-18(22)23-10-24-25(12)14/h7-8,10,13,16-17,27H,6,9,11H2,1-5H3,(H2,22,23,24)/t13-,16-,17-,21+/m1/s1 |
| InChIKey | WLVPNMCCPLYZAU-SJBXNIEPSA-N |
| XLogP | 1.17 |
| TPSA | 147.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|