C23H35N5O7 — CID 170056029
[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(2,2-dimethylpropanoyloxymethoxymethyl)-4-hydroxy-5-methyloxolan-3-yl] (2S)-2-amino-3-methylbutanoate (PubChem CID 170056029) has the molecular formula C23H35N5O7 and a molecular weight of 493.56 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(2,2-dimethylpropanoyloxymethoxymethyl)-4-hydroxy-5-methyloxolan-3-yl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(2,2-dimethylpropanoyloxymethoxymethyl)-4-hydroxy-5-methyloxolan-3-yl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 170056029 |
| Molecular Formula | C23H35N5O7 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(2,2-dimethylpropanoyloxymethoxymethyl)-4-hydroxy-5-methyloxolan-3-yl] (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)O[C@H]1[C@@H](O)[C@](C)(c2ccc3c(N)ncnn23)O[C@@H]1COCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H35N5O7/c1-12(2)16(24)20(30)34-17-14(9-32-11-33-21(31)22(3,4)5)35-23(6,18(17)29)15-8-7-13-19(25)26-10-27-28(13)15/h7-8,10,12,14,16-18,29H,9,11,24H2,1-6H3,(H2,25,26,27)/t14-,16+,17-,18-,23+/m1/s1 |
| InChIKey | YVWKGIOLBDOAOJ-CZOSJKKGSA-N |
| XLogP | 0.74 |
| TPSA | 173.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|