C19H26N4O5 — CID 170194596
[(3aR,4S,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2-methylpropanoate (PubChem CID 170194596) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is [(3aR,4S,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2-methylpropanoate.
| Compound Name | [(3aR,4S,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 170194596 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | [(3aR,4S,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC[C@H]1O[C@@](C)(c2ccc3c(N)ncnn23)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C19H26N4O5/c1-10(2)17(24)25-8-12-14-15(28-18(3,4)27-14)19(5,26-12)13-7-6-11-16(20)21-9-22-23(11)13/h6-7,9-10,12,14-15H,8H2,1-5H3,(H2,20,21,22)/t12-,14-,15-,19+/m1/s1 |
| InChIKey | RUNPHXXDWGIUGF-HHEAZKOWSA-N |
| XLogP | 1.64 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |