C21H31N5O4Si — CID 51034327
(3aR,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carbonitrile (PubChem CID 51034327) has the molecular formula C21H31N5O4Si and a molecular weight of 445.60 g/mol. Its IUPAC name is (3aR,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carbonitrile.
| Compound Name | (3aR,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carbonitrile |
|---|---|
| PubChem CID | 51034327 |
| Molecular Formula | C21H31N5O4Si |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (3aR,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carbonitrile |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)C(C#N)(c1ccc3c(N)ncnn13)O[C@@H]2CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H31N5O4Si/c1-19(2,3)31(6,7)27-10-14-16-17(30-20(4,5)29-16)21(11-22,28-14)15-9-8-13-18(23)24-12-25-26(13)15/h8-9,12,14,16-17H,10H2,1-7H3,(H2,23,24,25)/t14-,16-,17-,21?/m1/s1 |
| InChIKey | RQEBTINYJUDPKI-BROWDQIMSA-N |
| XLogP | 2.97 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|