C27H24Cl2N5O7P — CID 163260087
[(3aR,4R,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl bis(2-chlorophenyl) phosphate (PubChem CID 163260087) has the molecular formula C27H24Cl2N5O7P and a molecular weight of 632.40 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl bis(2-chlorophenyl) phosphate.
| Compound Name | [(3aR,4R,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl bis(2-chlorophenyl) phosphate |
|---|---|
| PubChem CID | 163260087 |
| Molecular Formula | C27H24Cl2N5O7P |
| Molecular Weight | 632.40 g/mol |
| Exact Mass | 631.08 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl bis(2-chlorophenyl) phosphate |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@](C#N)(c1ccc3c(N)ncnn13)O[C@@H]2COP(=O)(Oc1ccccc1Cl)Oc1ccccc1Cl |
| InChI | InChI=1S/C27H24Cl2N5O7P/c1-26(2)38-23-21(37-27(14-30,24(23)39-26)22-12-11-18-25(31)32-15-33-34(18)22)13-36-42(35,40-19-9-5-3-7-16(19)28)41-20-10-6-4-8-17(20)29/h3-12,15,21,23-24H,13H2,1-2H3,(H2,31,32,33)/t21-,23-,24-,27+/m1/s1 |
| InChIKey | YHQYWPFUKQLDSH-GZJGYMOFSA-N |
| XLogP | 5.54 |
| TPSA | 152.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.40 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|