C33H48ClN4O8P — CID 167057386
[(3aR,4S,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2-chlorophenyl) 3-nonoxypropyl phosphate (PubChem CID 167057386) has the molecular formula C33H48ClN4O8P and a molecular weight of 695.19 g/mol. Its IUPAC name is [(3aR,4S,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2-chlorophenyl) 3-nonoxypropyl phosphate.
| Compound Name | [(3aR,4S,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2-chlorophenyl) 3-nonoxypropyl phosphate |
|---|---|
| PubChem CID | 167057386 |
| Molecular Formula | C33H48ClN4O8P |
| Molecular Weight | 695.19 g/mol |
| Exact Mass | 694.29 |
| IUPAC Name | [(3aR,4S,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,2,4-trimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2-chlorophenyl) 3-nonoxypropyl phosphate |
| SMILES | CCCCCCCCCOCCCOP(=O)(OC[C@H]1O[C@@](C)(c2ccc3c(N)ncnn23)[C@@H]2OC(C)(C)O[C@@H]21)Oc1ccccc1Cl |
| InChI | InChI=1S/C33H48ClN4O8P/c1-5-6-7-8-9-10-13-19-40-20-14-21-41-47(39,46-26-16-12-11-15-24(26)34)42-22-27-29-30(45-32(2,3)44-29)33(4,43-27)28-18-17-25-31(35)36-23-37-38(25)28/h11-12,15-18,23,27,29-30H,5-10,13-14,19-22H2,1-4H3,(H2,35,36,37)/t27-,29-,30-,33+,47?/m1/s1 |
| InChIKey | PHSKHTZYCKNLKY-HWFNAVLASA-N |
| XLogP | 7.48 |
| TPSA | 137.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.19 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|