C33H38N5O8P — CID 174116892
[(3aS,4R,6R)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl benzyl [(2R)-2-phenylmethoxybutyl] phosphate (PubChem CID 174116892) has the molecular formula C33H38N5O8P and a molecular weight of 663.67 g/mol. Its IUPAC name is [(3aS,4R,6R)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl benzyl [(2R)-2-phenylmethoxybutyl] phosphate.
| Compound Name | [(3aS,4R,6R)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl benzyl [(2R)-2-phenylmethoxybutyl] phosphate |
|---|---|
| PubChem CID | 174116892 |
| Molecular Formula | C33H38N5O8P |
| Molecular Weight | 663.67 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | [(3aS,4R,6R)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl benzyl [(2R)-2-phenylmethoxybutyl] phosphate |
| SMILES | CC[C@H](COP(=O)(OCc1ccccc1)OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H]2OC(C)(C)OC12)OCc1ccccc1 |
| InChI | InChI=1S/C33H38N5O8P/c1-4-25(40-17-23-11-7-5-8-12-23)19-42-47(39,41-18-24-13-9-6-10-14-24)43-20-27-29-30(46-32(2,3)45-29)33(21-34,44-27)28-16-15-26-31(35)36-22-37-38(26)28/h5-16,22,25,27,29-30H,4,17-20H2,1-3H3,(H2,35,36,37)/t25-,27-,29?,30+,33+,47?/m1/s1 |
| InChIKey | QFPBOIZMKGRQNM-LSCGAZEESA-N |
| XLogP | 5.30 |
| TPSA | 161.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.67 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|