C27H41N5O6Si — CID 166531166
pentyl N-[7-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate (PubChem CID 166531166) has the molecular formula C27H41N5O6Si and a molecular weight of 559.74 g/mol. Its IUPAC name is pentyl N-[7-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate.
| Compound Name | pentyl N-[7-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate |
|---|---|
| PubChem CID | 166531166 |
| Molecular Formula | C27H41N5O6Si |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | pentyl N-[7-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate |
| SMILES | CCCCCOC(=O)Nc1ncnn2c([C@]3(C#N)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]4OC(C)(C)O[C@H]43)ccc12 |
| InChI | InChI=1S/C27H41N5O6Si/c1-9-10-11-14-34-24(33)31-23-18-12-13-20(32(18)30-17-29-23)27(16-28)22-21(37-26(5,6)38-22)19(36-27)15-35-39(7,8)25(2,3)4/h12-13,17,19,21-22H,9-11,14-15H2,1-8H3,(H,29,30,31,33)/t19-,21-,22-,27+/m1/s1 |
| InChIKey | BTOSRTUJTMKFEZ-UOTIDGTBSA-N |
| XLogP | 5.13 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|