C24H33N5O6 — CID 170056075
[(2S,5R)-5-cyano-5-[4-(pentoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate (PubChem CID 170056075) has the molecular formula C24H33N5O6 and a molecular weight of 487.56 g/mol. Its IUPAC name is [(2S,5R)-5-cyano-5-[4-(pentoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate.
| Compound Name | [(2S,5R)-5-cyano-5-[4-(pentoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 170056075 |
| Molecular Formula | C24H33N5O6 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | [(2S,5R)-5-cyano-5-[4-(pentoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate |
| SMILES | CCCCCOC(=O)Nc1ncnn2c([C@@]3(C#N)CC[C@@H](COCOC(=O)C(C)(C)C)O3)ccc12 |
| InChI | InChI=1S/C24H33N5O6/c1-5-6-7-12-33-22(31)28-20-18-8-9-19(29(18)27-15-26-20)24(14-25)11-10-17(35-24)13-32-16-34-21(30)23(2,3)4/h8-9,15,17H,5-7,10-13,16H2,1-4H3,(H,26,27,28,31)/t17-,24-/m0/s1 |
| InChIKey | JZOOLQGXCGJYOU-XDHUDOTRSA-N |
| XLogP | 3.93 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|