C21H27N5O7 — CID 166531031
[(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[4-(pentoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl propanoate (PubChem CID 166531031) has the molecular formula C21H27N5O7 and a molecular weight of 461.48 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[4-(pentoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl propanoate.
| Compound Name | [(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[4-(pentoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 166531031 |
| Molecular Formula | C21H27N5O7 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | [(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[4-(pentoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl propanoate |
| SMILES | CCCCCOC(=O)Nc1ncnn2c([C@]3(C#N)O[C@H](COC(=O)CC)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C21H27N5O7/c1-3-5-6-9-31-20(30)25-19-13-7-8-15(26(13)24-12-23-19)21(11-22)18(29)17(28)14(33-21)10-32-16(27)4-2/h7-8,12,14,17-18,28-29H,3-6,9-10H2,1-2H3,(H,23,24,25,30)/t14-,17-,18-,21+/m1/s1 |
| InChIKey | QNSAPMRUKCRYTO-UTQVJTIVSA-N |
| XLogP | 1.26 |
| TPSA | 168.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|