C24H25N5O6 — CID 167334662
[(2R,3S,4R,5R)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-phenylacetate (PubChem CID 167334662) has the molecular formula C24H25N5O6 and a molecular weight of 479.49 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-phenylacetate.
| Compound Name | [(2R,3S,4R,5R)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-phenylacetate |
|---|---|
| PubChem CID | 167334662 |
| Molecular Formula | C24H25N5O6 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-(butanoylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl 2-phenylacetate |
| SMILES | CCCC(=O)Nc1ncnn2c([C@]3(C#N)O[C@H](COC(=O)Cc4ccccc4)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C24H25N5O6/c1-2-6-19(30)28-23-16-9-10-18(29(16)27-14-26-23)24(13-25)22(33)21(32)17(35-24)12-34-20(31)11-15-7-4-3-5-8-15/h3-5,7-10,14,17,21-22,32-33H,2,6,11-12H2,1H3,(H,26,27,28,30)/t17-,21-,22-,24+/m1/s1 |
| InChIKey | CVVZCQUBTLDEDD-DBICXWQESA-N |
| XLogP | 1.09 |
| TPSA | 159.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |