C23H31N5O7 — CID 166530782
[(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[4-(pentoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 3-methylbutanoate (PubChem CID 166530782) has the molecular formula C23H31N5O7 and a molecular weight of 489.53 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[4-(pentoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[4-(pentoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 3-methylbutanoate |
|---|---|
| PubChem CID | 166530782 |
| Molecular Formula | C23H31N5O7 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | [(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[4-(pentoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl 3-methylbutanoate |
| SMILES | CCCCCOC(=O)Nc1ncnn2c([C@]3(C#N)O[C@H](COC(=O)CC(C)C)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C23H31N5O7/c1-4-5-6-9-33-22(32)27-21-15-7-8-17(28(15)26-13-25-21)23(12-24)20(31)19(30)16(35-23)11-34-18(29)10-14(2)3/h7-8,13-14,16,19-20,30-31H,4-6,9-11H2,1-3H3,(H,25,26,27,32)/t16-,19-,20-,23+/m1/s1 |
| InChIKey | ACHAGIUOIBGNPY-NNHNJENNSA-N |
| XLogP | 1.90 |
| TPSA | 168.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|