C18H23N5O6 — CID 168841133
pentyl N-[7-[(2R,3R,4S,5R)-2-cyano-5-[dideuterio(hydroxy)methyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate (PubChem CID 168841133) has the molecular formula C18H23N5O6 and a molecular weight of 407.42 g/mol. Its IUPAC name is pentyl N-[7-[(2R,3R,4S,5R)-2-cyano-5-[dideuterio(hydroxy)methyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate.
| Compound Name | pentyl N-[7-[(2R,3R,4S,5R)-2-cyano-5-[dideuterio(hydroxy)methyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate |
|---|---|
| PubChem CID | 168841133 |
| Molecular Formula | C18H23N5O6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | pentyl N-[7-[(2R,3R,4S,5R)-2-cyano-5-[dideuterio(hydroxy)methyl]-3,4-dihydroxyoxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate |
| SMILES | [2H]C([2H])(O)[C@H]1O[C@@](C#N)(c2ccc3c(NC(=O)OCCCCC)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H23N5O6/c1-2-3-4-7-28-17(27)22-16-11-5-6-13(23(11)21-10-20-16)18(9-19)15(26)14(25)12(8-24)29-18/h5-6,10,12,14-15,24-26H,2-4,7-8H2,1H3,(H,20,21,22,27)/t12-,14-,15-,18+/m1/s1/i8D2 |
| InChIKey | KVRKTRHVICJFAJ-XIGAXWTFSA-N |
| XLogP | 0.30 |
| TPSA | 162.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|