C33H56N5O9P — CID 176768833
[(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-2-hydroxy-12-nonoxydodecyl] hydrogen phosphate (PubChem CID 176768833) has the molecular formula C33H56N5O9P and a molecular weight of 697.81 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-2-hydroxy-12-nonoxydodecyl] hydrogen phosphate.
| Compound Name | [(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-2-hydroxy-12-nonoxydodecyl] hydrogen phosphate |
|---|---|
| PubChem CID | 176768833 |
| Molecular Formula | C33H56N5O9P |
| Molecular Weight | 697.81 g/mol |
| Exact Mass | 697.38 |
| IUPAC Name | [(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-2-hydroxy-12-nonoxydodecyl] hydrogen phosphate |
| SMILES | CCCCCCCCCOCCCCCCCCCC[C@@H](O)COP(=O)(O)OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@@H](O)C1O |
| InChI | InChI=1S/C33H56N5O9P/c1-2-3-4-5-9-12-15-20-44-21-16-13-10-7-6-8-11-14-17-26(39)22-45-48(42,43)46-23-28-30(40)31(41)33(24-34,47-28)29-19-18-27-32(35)36-25-37-38(27)29/h18-19,25-26,28,30-31,39-41H,2-17,20-23H2,1H3,(H,42,43)(H2,35,36,37)/t26-,28-,30?,31+,33+/m1/s1 |
| InChIKey | RCGHQMNLIXJRPB-GUNIPFCPSA-N |
| XLogP | 4.92 |
| TPSA | 214.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.81 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|